C18H19N3O3 — CID 54852116
4-[[3-(2,4-dimethoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline (PubChem CID 54852116) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[[3-(2,4-dimethoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline.
| Compound Name | 4-[[3-(2,4-dimethoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline |
|---|---|
| PubChem CID | 54852116 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[[3-(2,4-dimethoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline |
| SMILES | COc1ccc(-c2cc(COc3ccc(N)cc3)[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-22-15-7-8-16(18(10-15)23-2)17-9-13(20-21-17)11-24-14-5-3-12(19)4-6-14/h3-10H,11,19H2,1-2H3,(H,20,21) |
| InChIKey | JXSBPRGEFAHWDF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|