C20H23N3O — CID 54853371
3-[5-[(4-tert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline (PubChem CID 54853371) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[5-[(4-tert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline.
| Compound Name | 3-[5-[(4-tert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 54853371 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3-[5-[(4-tert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline |
| SMILES | CC(C)(C)c1ccc(OCc2cc(-c3cccc(N)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-20(2,3)15-7-9-18(10-8-15)24-13-17-12-19(23-22-17)14-5-4-6-16(21)11-14/h4-12H,13,21H2,1-3H3,(H,22,23) |
| InChIKey | KFXRSOJXVDYKTQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|