C19H21N3O3 — CID 54853248
2-[[3-[3-(2-methoxyethoxy)phenyl]-1H-pyrazol-5-yl]methoxy]aniline (PubChem CID 54853248) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[[3-[3-(2-methoxyethoxy)phenyl]-1H-pyrazol-5-yl]methoxy]aniline.
| Compound Name | 2-[[3-[3-(2-methoxyethoxy)phenyl]-1H-pyrazol-5-yl]methoxy]aniline |
|---|---|
| PubChem CID | 54853248 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[[3-[3-(2-methoxyethoxy)phenyl]-1H-pyrazol-5-yl]methoxy]aniline |
| SMILES | COCCOc1cccc(-c2cc(COc3ccccc3N)[nH]n2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-23-9-10-24-16-6-4-5-14(11-16)18-12-15(21-22-18)13-25-19-8-3-2-7-17(19)20/h2-8,11-12H,9-10,13,20H2,1H3,(H,21,22) |
| InChIKey | RRNUFNTVUQGIIP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|