C18H23N5O4 — CID 54853639
2-amino-N,N-diethyl-4-methyl-6-[1-(4-nitrophenoxy)ethyl]pyrimidine-5-carboxamide (PubChem CID 54853639) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-4-methyl-6-[1-(4-nitrophenoxy)ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-amino-N,N-diethyl-4-methyl-6-[1-(4-nitrophenoxy)ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54853639 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-amino-N,N-diethyl-4-methyl-6-[1-(4-nitrophenoxy)ethyl]pyrimidine-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)nc(N)nc1C(C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N5O4/c1-5-22(6-2)17(24)15-11(3)20-18(19)21-16(15)12(4)27-14-9-7-13(8-10-14)23(25)26/h7-10,12H,5-6H2,1-4H3,(H2,19,20,21) |
| InChIKey | ISQPAUBUZWNPEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|