C20H35N3O2 — CID 54855901
3-[4-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine (PubChem CID 54855901) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-[4-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine.
| Compound Name | 3-[4-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 54855901 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 3-[4-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine |
| SMILES | COc1cccc(CN2CCN(CCCN)CC2)c1OCCC(C)C |
| InChI | InChI=1S/C20H35N3O2/c1-17(2)8-15-25-20-18(6-4-7-19(20)24-3)16-23-13-11-22(12-14-23)10-5-9-21/h4,6-7,17H,5,8-16,21H2,1-3H3 |
| InChIKey | BGCQWFOIAUEQJS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |