About 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine
3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine (PubChem CID 54856520) has the molecular formula C21H37N3O3
and a molecular weight of 379.55 g/mol. Its IUPAC name is 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine |
| PubChem CID | 54856520 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine |
| SMILES | COc1cc(CN2CCN(CCCN)CC2)cc(OC)c1OCCC(C)C |
| InChI | InChI=1S/C21H37N3O3/c1-17(2)6-13-27-21-19(25-3)14-18(15-20(21)26-4)16-24-11-9-23(10-12-24)8-5-7-22/h14-15,17H,5-13,16,22H2,1-4H3 |
| InChIKey | QMHKHEDINJZLJO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine?
The IUPAC name of 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine (CID 54856520) is 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine.
What is the SMILES notation for 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine?
The canonical SMILES for 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine is COc1cc(CN2CCN(CCCN)CC2)cc(OC)c1OCCC(C)C.
What is the InChIKey of 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine?
The InChIKey is QMHKHEDINJZLJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N3O3/c1-17(2)6-13-27-21-19(25-3)14-18(15-20(21)26-4)16-24-11-9-23(10-12-24)8-5-7-22/h14-15,17H,5-13,16,22H2,1-4H3.
What are the key properties of 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine?
3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine has a molecular weight of 379.55 g/mol, XLogP of 2.60, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[3,5-dimethoxy-4-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propan-1-amine is sourced from PubChem (CID 54856520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).