C24H30BrN3O2 — CID 54856408
3-[4-[[3-bromo-5-methoxy-4-(3-phenylpropoxy)phenyl]methyl]piperazin-1-yl]propanenitrile (PubChem CID 54856408) has the molecular formula C24H30BrN3O2 and a molecular weight of 472.43 g/mol. Its IUPAC name is 3-[4-[[3-bromo-5-methoxy-4-(3-phenylpropoxy)phenyl]methyl]piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-[[3-bromo-5-methoxy-4-(3-phenylpropoxy)phenyl]methyl]piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 54856408 |
| Molecular Formula | C24H30BrN3O2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[4-[[3-bromo-5-methoxy-4-(3-phenylpropoxy)phenyl]methyl]piperazin-1-yl]propanenitrile |
| SMILES | COc1cc(CN2CCN(CCC#N)CC2)cc(Br)c1OCCCc1ccccc1 |
| InChI | InChI=1S/C24H30BrN3O2/c1-29-23-18-21(19-28-14-12-27(13-15-28)11-6-10-26)17-22(25)24(23)30-16-5-9-20-7-3-2-4-8-20/h2-4,7-8,17-18H,5-6,9,11-16,19H2,1H3 |
| InChIKey | OGAPWRYRPNTRGQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|