C13H14BrClN2O — CID 54865355
4-N-[(5-bromofuran-2-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 54865355) has the molecular formula C13H14BrClN2O and a molecular weight of 329.63 g/mol. Its IUPAC name is 4-N-[(5-bromofuran-2-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-[(5-bromofuran-2-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 54865355 |
| Molecular Formula | C13H14BrClN2O |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-N-[(5-bromofuran-2-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCc2ccc(Br)o2)cc1Cl |
| InChI | InChI=1S/C13H14BrClN2O/c1-17(2)12-5-3-9(7-11(12)15)16-8-10-4-6-13(14)18-10/h3-7,16H,8H2,1-2H3 |
| InChIKey | PZZDEJXOAVQJPN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|