C11H13BrN4O2 — CID 54866454
2-[4-[(5-bromofuran-2-yl)methylamino]pyrazol-1-yl]-N-methylacetamide (PubChem CID 54866454) has the molecular formula C11H13BrN4O2 and a molecular weight of 313.16 g/mol. Its IUPAC name is 2-[4-[(5-bromofuran-2-yl)methylamino]pyrazol-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(5-bromofuran-2-yl)methylamino]pyrazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 54866454 |
| Molecular Formula | C11H13BrN4O2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[4-[(5-bromofuran-2-yl)methylamino]pyrazol-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1cc(NCc2ccc(Br)o2)cn1 |
| InChI | InChI=1S/C11H13BrN4O2/c1-13-11(17)7-16-6-8(4-15-16)14-5-9-2-3-10(12)18-9/h2-4,6,14H,5,7H2,1H3,(H,13,17) |
| InChIKey | SVAQWCBNEORRRC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |