C16H27NO2 — CID 54867005
ethyl 4-(cyclohex-3-en-1-ylmethylamino)cyclohexane-1-carboxylate (PubChem CID 54867005) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is ethyl 4-(cyclohex-3-en-1-ylmethylamino)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(cyclohex-3-en-1-ylmethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54867005 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethyl 4-(cyclohex-3-en-1-ylmethylamino)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NCC2CC=CCC2)CC1 |
| InChI | InChI=1S/C16H27NO2/c1-2-19-16(18)14-8-10-15(11-9-14)17-12-13-6-4-3-5-7-13/h3-4,13-15,17H,2,5-12H2,1H3 |
| InChIKey | WDHCEOHNEGDBIM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|