C12H23NO5 — CID 54867533
2,2-diethyl-4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid (PubChem CID 54867533) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,2-diethyl-4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54867533 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2,2-diethyl-4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)NCCOCCO)C(=O)O |
| InChI | InChI=1S/C12H23NO5/c1-3-12(4-2,11(16)17)9-10(15)13-5-7-18-8-6-14/h14H,3-9H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | BGLLBQIAHAEPBV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|