C11H18N4O3 — CID 54867805
6-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-6-oxohexanoic acid (PubChem CID 54867805) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-6-oxohexanoic acid.
| Compound Name | 6-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 54867805 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 6-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-6-oxohexanoic acid |
| SMILES | CC(NC(=O)CCCCC(=O)O)c1nncn1C |
| InChI | InChI=1S/C11H18N4O3/c1-8(11-14-12-7-15(11)2)13-9(16)5-3-4-6-10(17)18/h7-8H,3-6H2,1-2H3,(H,13,16)(H,17,18) |
| InChIKey | ZCKGJCGAYXKBOL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|