C11H21N5O — CID 82847987
5-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide (PubChem CID 82847987) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide.
| Compound Name | 5-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 82847987 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide |
| SMILES | CC(N)CCCC(=O)NC(C)c1nncn1C |
| InChI | InChI=1S/C11H21N5O/c1-8(12)5-4-6-10(17)14-9(2)11-15-13-7-16(11)3/h7-9H,4-6,12H2,1-3H3,(H,14,17) |
| InChIKey | FKHMOJHZMMWFEM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |