C12H23F3N2O2 — CID 54871759
2-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)pentanamide (PubChem CID 54871759) has the molecular formula C12H23F3N2O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)pentanamide.
| Compound Name | 2-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)pentanamide |
|---|---|
| PubChem CID | 54871759 |
| Molecular Formula | C12H23F3N2O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)pentanamide |
| SMILES | CCCC(N)C(=O)N(CCCOCC)CC(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O2/c1-3-6-10(16)11(18)17(9-12(13,14)15)7-5-8-19-4-2/h10H,3-9,16H2,1-2H3 |
| InChIKey | LQKMQRPLZFEPPR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|