C10H14F3N3O — CID 54876873
N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide (PubChem CID 54876873) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 54876873 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H14F3N3O/c1-2-3-4-16(7-10(11,12)13)9(17)8-5-14-15-6-8/h5-6H,2-4,7H2,1H3,(H,14,15) |
| InChIKey | QOVRJGRLXLWJOQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |