C13H18ClNO2S2 — CID 54877478
5-(3-chloropropylsulfonyl)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 54877478) has the molecular formula C13H18ClNO2S2 and a molecular weight of 319.88 g/mol. Its IUPAC name is 5-(3-chloropropylsulfonyl)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(3-chloropropylsulfonyl)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 54877478 |
| Molecular Formula | C13H18ClNO2S2 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 5-(3-chloropropylsulfonyl)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=S(=O)(CCCCl)N1CCc2sccc2C1C1CC1 |
| InChI | InChI=1S/C13H18ClNO2S2/c14-6-1-9-19(16,17)15-7-4-12-11(5-8-18-12)13(15)10-2-3-10/h5,8,10,13H,1-4,6-7,9H2 |
| InChIKey | QOWZADBLGVNZNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|