C13H20BrN3O2 — CID 54877994
4-bromo-N-(2-hydroxyethyl)-N-(1-methylpiperidin-4-yl)-1H-pyrrole-2-carboxamide (PubChem CID 54877994) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 4-bromo-N-(2-hydroxyethyl)-N-(1-methylpiperidin-4-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-hydroxyethyl)-N-(1-methylpiperidin-4-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54877994 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-bromo-N-(2-hydroxyethyl)-N-(1-methylpiperidin-4-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CN1CCC(N(CCO)C(=O)c2cc(Br)c[nH]2)CC1 |
| InChI | InChI=1S/C13H20BrN3O2/c1-16-4-2-11(3-5-16)17(6-7-18)13(19)12-8-10(14)9-15-12/h8-9,11,15,18H,2-7H2,1H3 |
| InChIKey | OZKASGNIJPCVCX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |