C14H20BrN3O — CID 106626847
4-bromo-N-cyclopropyl-N-(piperidin-2-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 106626847) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 4-bromo-N-cyclopropyl-N-(piperidin-2-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-cyclopropyl-N-(piperidin-2-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106626847 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-bromo-N-cyclopropyl-N-(piperidin-2-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(c1cc(Br)c[nH]1)N(CC1CCCCN1)C1CC1 |
| InChI | InChI=1S/C14H20BrN3O/c15-10-7-13(17-8-10)14(19)18(12-4-5-12)9-11-3-1-2-6-16-11/h7-8,11-12,16-17H,1-6,9H2 |
| InChIKey | WZQWFTBJWLDAJV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |