C12H10BrF2NO2 — CID 54880486
(5-bromofuran-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanamine (PubChem CID 54880486) has the molecular formula C12H10BrF2NO2 and a molecular weight of 318.12 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanamine.
| Compound Name | (5-bromofuran-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 54880486 |
| Molecular Formula | C12H10BrF2NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | (5-bromofuran-2-yl)-(2,6-difluoro-4-methoxyphenyl)methanamine |
| SMILES | COc1cc(F)c(C(N)c2ccc(Br)o2)c(F)c1 |
| InChI | InChI=1S/C12H10BrF2NO2/c1-17-6-4-7(14)11(8(15)5-6)12(16)9-2-3-10(13)18-9/h2-5,12H,16H2,1H3 |
| InChIKey | ZSSLRMPQIJGIOD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |