About 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline
2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline (PubChem CID 54881187) has the molecular formula C11H10BrF2N3
and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline.
Molecular Properties
| Compound Name | 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline |
| PubChem CID | 54881187 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline |
| SMILES | CC(Nc1c(F)cc(F)cc1Br)c1ccn[nH]1 |
| InChI | InChI=1S/C11H10BrF2N3/c1-6(10-2-3-15-17-10)16-11-8(12)4-7(13)5-9(11)14/h2-6,16H,1H3,(H,15,17) |
| InChIKey | OBPUHZVOBZRTQN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline?
The IUPAC name of 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline (CID 54881187) is 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline.
What is the SMILES notation for 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline?
The canonical SMILES for 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline is CC(Nc1c(F)cc(F)cc1Br)c1ccn[nH]1.
What is the InChIKey of 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline?
The InChIKey is OBPUHZVOBZRTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2N3/c1-6(10-2-3-15-17-10)16-11-8(12)4-7(13)5-9(11)14/h2-6,16H,1H3,(H,15,17).
What are the key properties of 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline?
2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline has a molecular weight of 302.12 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline is sourced from PubChem (CID 54881187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).