C11H11F2N3 — CID 60972171
2,5-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline (PubChem CID 60972171) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2,5-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline.
| Compound Name | 2,5-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 60972171 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2,5-difluoro-N-[1-(1H-pyrazol-5-yl)ethyl]aniline |
| SMILES | CC(Nc1cc(F)ccc1F)c1ccn[nH]1 |
| InChI | InChI=1S/C11H11F2N3/c1-7(10-4-5-14-16-10)15-11-6-8(12)2-3-9(11)13/h2-7,15H,1H3,(H,14,16) |
| InChIKey | ODCPLYRCZDKGTM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |