C13H13FN4 — CID 54881919
3-fluoro-4-methyl-5-[1-(1H-pyrazol-5-yl)ethylamino]benzonitrile (PubChem CID 54881919) has the molecular formula C13H13FN4 and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-fluoro-4-methyl-5-[1-(1H-pyrazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 3-fluoro-4-methyl-5-[1-(1H-pyrazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 54881919 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-fluoro-4-methyl-5-[1-(1H-pyrazol-5-yl)ethylamino]benzonitrile |
| SMILES | Cc1c(F)cc(C#N)cc1NC(C)c1ccn[nH]1 |
| InChI | InChI=1S/C13H13FN4/c1-8-11(14)5-10(7-15)6-13(8)17-9(2)12-3-4-16-18-12/h3-6,9,17H,1-2H3,(H,16,18) |
| InChIKey | KHKUOJDSKXAQLK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |