C12H12FN7 — CID 60972679
2-fluoro-N-[1-(1H-pyrazol-5-yl)ethyl]-5-(tetrazol-1-yl)aniline (PubChem CID 60972679) has the molecular formula C12H12FN7 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-fluoro-N-[1-(1H-pyrazol-5-yl)ethyl]-5-(tetrazol-1-yl)aniline.
| Compound Name | 2-fluoro-N-[1-(1H-pyrazol-5-yl)ethyl]-5-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 60972679 |
| Molecular Formula | C12H12FN7 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-fluoro-N-[1-(1H-pyrazol-5-yl)ethyl]-5-(tetrazol-1-yl)aniline |
| SMILES | CC(Nc1cc(-n2cnnn2)ccc1F)c1ccn[nH]1 |
| InChI | InChI=1S/C12H12FN7/c1-8(11-4-5-14-17-11)16-12-6-9(2-3-10(12)13)20-7-15-18-19-20/h2-8,16H,1H3,(H,14,17) |
| InChIKey | XFHBEGRKOVOPJE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |