C12H16N4O2S — CID 54881791
N-[2-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]methanesulfonamide (PubChem CID 54881791) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-[2-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]methanesulfonamide.
| Compound Name | N-[2-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 54881791 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[2-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]methanesulfonamide |
| SMILES | CC(Nc1ccccc1NS(C)(=O)=O)c1ccn[nH]1 |
| InChI | InChI=1S/C12H16N4O2S/c1-9(10-7-8-13-15-10)14-11-5-3-4-6-12(11)16-19(2,17)18/h3-9,14,16H,1-2H3,(H,13,15) |
| InChIKey | DEISQBYIWWEUNP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |