C14H9ClF2N2 — CID 54887309
2-(2-chloroanilino)-2-(2,6-difluorophenyl)acetonitrile (PubChem CID 54887309) has the molecular formula C14H9ClF2N2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 2-(2-chloroanilino)-2-(2,6-difluorophenyl)acetonitrile.
| Compound Name | 2-(2-chloroanilino)-2-(2,6-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54887309 |
| Molecular Formula | C14H9ClF2N2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(2-chloroanilino)-2-(2,6-difluorophenyl)acetonitrile |
| SMILES | N#CC(Nc1ccccc1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C14H9ClF2N2/c15-9-4-1-2-7-12(9)19-13(8-18)14-10(16)5-3-6-11(14)17/h1-7,13,19H |
| InChIKey | DWPXLSMILRZYHE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |