C11H10F2N2 — CID 43151692
2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetonitrile (PubChem CID 43151692) has the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetonitrile.
| Compound Name | 2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 43151692 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetonitrile |
| SMILES | N#CC(NC1CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C11H10F2N2/c12-8-2-1-3-9(13)11(8)10(6-14)15-7-4-5-7/h1-3,7,10,15H,4-5H2 |
| InChIKey | YCSPGCUAZMIZHQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |