About 1-hydroxy-3,7-dimethoxyxanthen-9-one
1-hydroxy-3,7-dimethoxyxanthen-9-one (PubChem CID 5488808) has the molecular formula C15H12O5
and a molecular weight of 272.26 g/mol. Its IUPAC name is 1-hydroxy-3,7-dimethoxyxanthen-9-one.
Molecular Properties
| Compound Name | 1-hydroxy-3,7-dimethoxyxanthen-9-one |
| PubChem CID | 5488808 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-hydroxy-3,7-dimethoxyxanthen-9-one |
| SMILES | COc1cc(O)c2c(=O)c3cc(OC)ccc3oc2c1 |
| InChI | InChI=1S/C15H12O5/c1-18-8-3-4-12-10(5-8)15(17)14-11(16)6-9(19-2)7-13(14)20-12/h3-7,16H,1-2H3 |
| InChIKey | FWBPZAVSTQBRKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,7-dimethoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,7-dimethoxyxanthen-9-one?
The IUPAC name of 1-hydroxy-3,7-dimethoxyxanthen-9-one (CID 5488808) is 1-hydroxy-3,7-dimethoxyxanthen-9-one.
What is the SMILES notation for 1-hydroxy-3,7-dimethoxyxanthen-9-one?
The canonical SMILES for 1-hydroxy-3,7-dimethoxyxanthen-9-one is COc1cc(O)c2c(=O)c3cc(OC)ccc3oc2c1.
What is the InChIKey of 1-hydroxy-3,7-dimethoxyxanthen-9-one?
The InChIKey is FWBPZAVSTQBRKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5/c1-18-8-3-4-12-10(5-8)15(17)14-11(16)6-9(19-2)7-13(14)20-12/h3-7,16H,1-2H3.
What are the key properties of 1-hydroxy-3,7-dimethoxyxanthen-9-one?
1-hydroxy-3,7-dimethoxyxanthen-9-one has a molecular weight of 272.26 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,7-dimethoxyxanthen-9-one is sourced from PubChem (CID 5488808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).