C13H14N2O3S — CID 54890942
2-(3,4-dihydroxyphenyl)-2-(thiophen-2-ylmethylamino)acetamide (PubChem CID 54890942) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-2-(thiophen-2-ylmethylamino)acetamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-2-(thiophen-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 54890942 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-(thiophen-2-ylmethylamino)acetamide |
| SMILES | NC(=O)C(NCc1cccs1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H14N2O3S/c14-13(18)12(15-7-9-2-1-5-19-9)8-3-4-10(16)11(17)6-8/h1-6,12,15-17H,7H2,(H2,14,18) |
| InChIKey | GFFJUALDLGPAER-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|