C11H14N4OS — CID 66117109
2-(3-methylimidazol-4-yl)-2-(thiophen-2-ylmethylamino)acetamide (PubChem CID 66117109) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-(3-methylimidazol-4-yl)-2-(thiophen-2-ylmethylamino)acetamide.
| Compound Name | 2-(3-methylimidazol-4-yl)-2-(thiophen-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 66117109 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(3-methylimidazol-4-yl)-2-(thiophen-2-ylmethylamino)acetamide |
| SMILES | Cn1cncc1C(NCc1cccs1)C(N)=O |
| InChI | InChI=1S/C11H14N4OS/c1-15-7-13-6-9(15)10(11(12)16)14-5-8-3-2-4-17-8/h2-4,6-7,10,14H,5H2,1H3,(H2,12,16) |
| InChIKey | NCRGNWPFYGKINR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |