C14H22N2O2 — CID 54892038
2-(2-methoxyanilino)-2,4-dimethylpentanamide (PubChem CID 54892038) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-2,4-dimethylpentanamide.
| Compound Name | 2-(2-methoxyanilino)-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 54892038 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(2-methoxyanilino)-2,4-dimethylpentanamide |
| SMILES | COc1ccccc1NC(C)(CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H22N2O2/c1-10(2)9-14(3,13(15)17)16-11-7-5-6-8-12(11)18-4/h5-8,10,16H,9H2,1-4H3,(H2,15,17) |
| InChIKey | WQFQJSCBEUELLM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |