About 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide
2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide (PubChem CID 54892289) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide |
| PubChem CID | 54892289 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide |
| SMILES | NC(=O)C1(N2CCNCC2)CCc2ccccc2C1 |
| InChI | InChI=1S/C15H21N3O/c16-14(19)15(18-9-7-17-8-10-18)6-5-12-3-1-2-4-13(12)11-15/h1-4,17H,5-11H2,(H2,16,19) |
| InChIKey | PDPKJNIOGONTNK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide?
The IUPAC name of 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide (CID 54892289) is 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide.
What is the SMILES notation for 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide?
The canonical SMILES for 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide is NC(=O)C1(N2CCNCC2)CCc2ccccc2C1.
What is the InChIKey of 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide?
The InChIKey is PDPKJNIOGONTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c16-14(19)15(18-9-7-17-8-10-18)6-5-12-3-1-2-4-13(12)11-15/h1-4,17H,5-11H2,(H2,16,19).
What are the key properties of 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide?
2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide has a molecular weight of 259.35 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-3,4-dihydro-1H-naphthalene-2-carboxamide is sourced from PubChem (CID 54892289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).