C15H18FN3 — CID 54896470
3-(4-fluorophenyl)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]cyclobutan-1-amine (PubChem CID 54896470) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]cyclobutan-1-amine.
| Compound Name | 3-(4-fluorophenyl)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 54896470 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]cyclobutan-1-amine |
| SMILES | Cc1[nH]ncc1CNC1CC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H18FN3/c1-10-13(9-18-19-10)8-17-15-6-12(7-15)11-2-4-14(16)5-3-11/h2-5,9,12,15,17H,6-8H2,1H3,(H,18,19) |
| InChIKey | MGRNFPVRMAWSLU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |