C14H16FN3 — CID 54897195
3-(4-fluorophenyl)-N-(1H-pyrazol-4-ylmethyl)cyclobutan-1-amine (PubChem CID 54897195) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(1H-pyrazol-4-ylmethyl)cyclobutan-1-amine.
| Compound Name | 3-(4-fluorophenyl)-N-(1H-pyrazol-4-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 54897195 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(1H-pyrazol-4-ylmethyl)cyclobutan-1-amine |
| SMILES | Fc1ccc(C2CC(NCc3cn[nH]c3)C2)cc1 |
| InChI | InChI=1S/C14H16FN3/c15-13-3-1-11(2-4-13)12-5-14(6-12)16-7-10-8-17-18-9-10/h1-4,8-9,12,14,16H,5-7H2,(H,17,18) |
| InChIKey | LHNWYPODDFUWGT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |