C17H16ClF2N — CID 62537092
N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-fluorophenyl)cyclobutan-1-amine (PubChem CID 62537092) has the molecular formula C17H16ClF2N and a molecular weight of 307.77 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-fluorophenyl)cyclobutan-1-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-fluorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 62537092 |
| Molecular Formula | C17H16ClF2N |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-fluorophenyl)cyclobutan-1-amine |
| SMILES | Fc1ccc(C2CC(NCc3ccc(F)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C17H16ClF2N/c18-16-7-11(1-6-17(16)20)10-21-15-8-13(9-15)12-2-4-14(19)5-3-12/h1-7,13,15,21H,8-10H2 |
| InChIKey | ZKUWFMWDGZIWMH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |