2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid

C11H16N2O4 — CID 54899446

IUPAC2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCCN1C1CC(=O)NC1=O
InChIInChI=1S/C11H16N2O4/c14-9-6-8(11(17)12-9)13-4-2-1-3-7(13)5-10(15)16/h7-8H,1-6H2,(H,15,16)(H,12,14,17)
InChIKeyMHUUUZVLLXMUKG-UHFFFAOYSA-N
MW240.26 g/mol
LogP-0.27
Rot. Bonds3

About 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid

2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid (PubChem CID 54899446) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid
PubChem CID54899446
Molecular FormulaC11H16N2O4
Molecular Weight240.26 g/mol
Exact Mass240.11
IUPAC Name2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCCN1C1CC(=O)NC1=O
InChIInChI=1S/C11H16N2O4/c14-9-6-8(11(17)12-9)13-4-2-1-3-7(13)5-10(15)16/h7-8H,1-6H2,(H,15,16)(H,12,14,17)
InChIKeyMHUUUZVLLXMUKG-UHFFFAOYSA-N
XLogP-0.27
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 5-0.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid?
The IUPAC name of 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid (CID 54899446) is 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid?
The canonical SMILES for 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid is O=C(O)CC1CCCCN1C1CC(=O)NC1=O.
What is the InChIKey of 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid?
The InChIKey is MHUUUZVLLXMUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c14-9-6-8(11(17)12-9)13-4-2-1-3-7(13)5-10(15)16/h7-8H,1-6H2,(H,15,16)(H,12,14,17).
What are the key properties of 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid?
2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid has a molecular weight of 240.26 g/mol, XLogP of -0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,5-dioxopyrrolidin-3-yl)piperidin-2-yl]acetic acid is sourced from PubChem (CID 54899446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).