C16H24N2O — CID 54901056
N-butan-2-yl-3-(2,3-dihydro-1H-inden-2-ylamino)propanamide (PubChem CID 54901056) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-butan-2-yl-3-(2,3-dihydro-1H-inden-2-ylamino)propanamide.
| Compound Name | N-butan-2-yl-3-(2,3-dihydro-1H-inden-2-ylamino)propanamide |
|---|---|
| PubChem CID | 54901056 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-butan-2-yl-3-(2,3-dihydro-1H-inden-2-ylamino)propanamide |
| SMILES | CCC(C)NC(=O)CCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H24N2O/c1-3-12(2)18-16(19)8-9-17-15-10-13-6-4-5-7-14(13)11-15/h4-7,12,15,17H,3,8-11H2,1-2H3,(H,18,19) |
| InChIKey | DOTDIHITZPHKIE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |