C13H15N3O — CID 54903159
2-(1,2-oxazol-4-ylmethyl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 54903159) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(1,2-oxazol-4-ylmethyl)-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(1,2-oxazol-4-ylmethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 54903159 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(1,2-oxazol-4-ylmethyl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(Cc1cnoc1)C2 |
| InChI | InChI=1S/C13H15N3O/c14-13-3-1-2-11-8-16(5-4-12(11)13)7-10-6-15-17-9-10/h1-3,6,9H,4-5,7-8,14H2 |
| InChIKey | DJQPWZQRKXEUHQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|