C12H11ClN6 — CID 54903551
4-chloro-3-N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzene-1,3-diamine (PubChem CID 54903551) has the molecular formula C12H11ClN6 and a molecular weight of 274.72 g/mol. Its IUPAC name is 4-chloro-3-N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 54903551 |
| Molecular Formula | C12H11ClN6 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-chloro-3-N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzene-1,3-diamine |
| SMILES | Cc1cc(Nc2cc(N)ccc2Cl)n2ncnc2n1 |
| InChI | InChI=1S/C12H11ClN6/c1-7-4-11(19-12(17-7)15-6-16-19)18-10-5-8(14)2-3-9(10)13/h2-6,18H,14H2,1H3 |
| InChIKey | DZOZWXNYJNADSH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|