C11H15F3N2O — CID 54904451
N-(1-cyanocycloheptyl)-3,3,3-trifluoropropanamide (PubChem CID 54904451) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(1-cyanocycloheptyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 54904451 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(1-cyanocycloheptyl)-3,3,3-trifluoropropanamide |
| SMILES | N#CC1(NC(=O)CC(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C11H15F3N2O/c12-11(13,14)7-9(17)16-10(8-15)5-3-1-2-4-6-10/h1-7H2,(H,16,17) |
| InChIKey | VKTGYABNIXFGHO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |