C10H13F3N2O — CID 55138929
N-(1-cyanocycloheptyl)-2,2,2-trifluoroacetamide (PubChem CID 55138929) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 55138929 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2,2,2-trifluoroacetamide |
| SMILES | N#CC1(NC(=O)C(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)8(16)15-9(7-14)5-3-1-2-4-6-9/h1-6H2,(H,15,16) |
| InChIKey | PPNKSFJKOVDCSO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |