C14H24N2O2S — CID 54904902
N,N-dimethyl-4-[1-(3-methylsulfonylpropylamino)ethyl]aniline (PubChem CID 54904902) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(3-methylsulfonylpropylamino)ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(3-methylsulfonylpropylamino)ethyl]aniline |
|---|---|
| PubChem CID | 54904902 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N,N-dimethyl-4-[1-(3-methylsulfonylpropylamino)ethyl]aniline |
| SMILES | CC(NCCCS(C)(=O)=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-12(15-10-5-11-19(4,17)18)13-6-8-14(9-7-13)16(2)3/h6-9,12,15H,5,10-11H2,1-4H3 |
| InChIKey | HKOJVSNUPLDBCX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|