C13H23N3O2S — CID 54907288
N-(4-ethylcyclohexyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 54907288) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(4-ethylcyclohexyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54907288 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(4-ethylcyclohexyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCC1CCC(N(C)S(=O)(=O)c2cn[nH]c2C)CC1 |
| InChI | InChI=1S/C13H23N3O2S/c1-4-11-5-7-12(8-6-11)16(3)19(17,18)13-9-14-15-10(13)2/h9,11-12H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | VUXHHGTVLRTBGT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |