C10H12N2O4S2 — CID 54907618
5-[2-cyanopropyl(methyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 54907618) has the molecular formula C10H12N2O4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[2-cyanopropyl(methyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-cyanopropyl(methyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 54907618 |
| Molecular Formula | C10H12N2O4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 5-[2-cyanopropyl(methyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(C#N)CN(C)S(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H12N2O4S2/c1-7(5-11)6-12(2)18(15,16)9-4-3-8(17-9)10(13)14/h3-4,7H,6H2,1-2H3,(H,13,14) |
| InChIKey | RLVWTAXGAGJFLG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |