C15H16FN — CID 54912650
[4-(3,5-dimethylphenyl)-2-fluorophenyl]methanamine (PubChem CID 54912650) has the molecular formula C15H16FN and a molecular weight of 229.30 g/mol. Its IUPAC name is [4-(3,5-dimethylphenyl)-2-fluorophenyl]methanamine.
| Compound Name | [4-(3,5-dimethylphenyl)-2-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 54912650 |
| Molecular Formula | C15H16FN |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [4-(3,5-dimethylphenyl)-2-fluorophenyl]methanamine |
| SMILES | Cc1cc(C)cc(-c2ccc(CN)c(F)c2)c1 |
| InChI | InChI=1S/C15H16FN/c1-10-5-11(2)7-14(6-10)12-3-4-13(9-17)15(16)8-12/h3-8H,9,17H2,1-2H3 |
| InChIKey | ZPOWIVFBMLEHOB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |