C14H17BrN2OS — CID 54913214
4-bromo-2-[1-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]phenol (PubChem CID 54913214) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 4-bromo-2-[1-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]phenol.
| Compound Name | 4-bromo-2-[1-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]phenol |
|---|---|
| PubChem CID | 54913214 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-bromo-2-[1-[(4-methyl-1,3-thiazol-2-yl)methylamino]propyl]phenol |
| SMILES | CCC(NCc1nc(C)cs1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H17BrN2OS/c1-3-12(11-6-10(15)4-5-13(11)18)16-7-14-17-9(2)8-19-14/h4-6,8,12,16,18H,3,7H2,1-2H3 |
| InChIKey | ZLJCIUMCCQYYKN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|