C14H12N4O — CID 54913836
5-amino-N-(2-cyanophenyl)-2-methylpyridine-3-carboxamide (PubChem CID 54913836) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 5-amino-N-(2-cyanophenyl)-2-methylpyridine-3-carboxamide.
| Compound Name | 5-amino-N-(2-cyanophenyl)-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 54913836 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-amino-N-(2-cyanophenyl)-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncc(N)cc1C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C14H12N4O/c1-9-12(6-11(16)8-17-9)14(19)18-13-5-3-2-4-10(13)7-15/h2-6,8H,16H2,1H3,(H,18,19) |
| InChIKey | CUXXEBLVJUTQKN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |