C14H15N3OS — CID 61117272
5-amino-2-methyl-N-(2-methylsulfanylphenyl)pyridine-3-carboxamide (PubChem CID 61117272) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 5-amino-2-methyl-N-(2-methylsulfanylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-amino-2-methyl-N-(2-methylsulfanylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61117272 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-amino-2-methyl-N-(2-methylsulfanylphenyl)pyridine-3-carboxamide |
| SMILES | CSc1ccccc1NC(=O)c1cc(N)cnc1C |
| InChI | InChI=1S/C14H15N3OS/c1-9-11(7-10(15)8-16-9)14(18)17-12-5-3-4-6-13(12)19-2/h3-8H,15H2,1-2H3,(H,17,18) |
| InChIKey | HFCKTEUGUZREBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |