C11H14N4O3S — CID 54915290
N-[2-(2-aminophenoxy)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 54915290) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-[2-(2-aminophenoxy)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(2-aminophenoxy)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54915290 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-[2-(2-aminophenoxy)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1ccccc1OCCNS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C11H14N4O3S/c12-10-3-1-2-4-11(10)18-6-5-15-19(16,17)9-7-13-14-8-9/h1-4,7-8,15H,5-6,12H2,(H,13,14) |
| InChIKey | QNDBDSXASVQISB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|