C17H26N2 — CID 54918791
[2-(azepan-1-yl)-3,4-dihydro-1H-naphthalen-2-yl]methanamine (PubChem CID 54918791) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [2-(azepan-1-yl)-3,4-dihydro-1H-naphthalen-2-yl]methanamine.
| Compound Name | [2-(azepan-1-yl)-3,4-dihydro-1H-naphthalen-2-yl]methanamine |
|---|---|
| PubChem CID | 54918791 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | [2-(azepan-1-yl)-3,4-dihydro-1H-naphthalen-2-yl]methanamine |
| SMILES | NCC1(N2CCCCCC2)CCc2ccccc2C1 |
| InChI | InChI=1S/C17H26N2/c18-14-17(19-11-5-1-2-6-12-19)10-9-15-7-3-4-8-16(15)13-17/h3-4,7-8H,1-2,5-6,9-14,18H2 |
| InChIKey | RCEPBJCQHGRBCE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |