C12H16FN3O2S — CID 54919691
1-(5-fluoro-1-methylbenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine (PubChem CID 54919691) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-(5-fluoro-1-methylbenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-(5-fluoro-1-methylbenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 54919691 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-(5-fluoro-1-methylbenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine |
| SMILES | Cn1c(C(N)CCS(C)(=O)=O)nc2cc(F)ccc21 |
| InChI | InChI=1S/C12H16FN3O2S/c1-16-11-4-3-8(13)7-10(11)15-12(16)9(14)5-6-19(2,17)18/h3-4,7,9H,5-6,14H2,1-2H3 |
| InChIKey | GZHSXAWHAARDIC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |